C15H20N2O2 — CID 99641963
(NE)-N-[(1S)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine (PubChem CID 99641963) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (NE)-N-[(1S)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 99641963 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (NE)-N-[(1S)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
| SMILES | C[C@@H]1CN([C@@H]2/C(=N/O)Cc3ccccc32)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H20N2O2/c1-10-8-17(9-11(2)19-10)15-13-6-4-3-5-12(13)7-14(15)16-18/h3-6,10-11,15,18H,7-9H2,1-2H3/b16-14+/t10-,11-,15+/m1/s1 |
| InChIKey | PTLJUPIMAYRXCX-PYLXOACDSA-N |
| XLogP | 2.22 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|