C20H21NO2 — CID 39878233
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(9H-fluoren-2-yl)methanone (PubChem CID 39878233) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(9H-fluoren-2-yl)methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(9H-fluoren-2-yl)methanone |
|---|---|
| PubChem CID | 39878233 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(9H-fluoren-2-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc3c(c2)Cc2ccccc2-3)C[C@H](C)O1 |
| InChI | InChI=1S/C20H21NO2/c1-13-11-21(12-14(2)23-13)20(22)16-7-8-19-17(10-16)9-15-5-3-4-6-18(15)19/h3-8,10,13-14H,9,11-12H2,1-2H3/t13-,14+ |
| InChIKey | DTXSBQNKUWQGCI-OKILXGFUSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |