C28H26N2O2 — CID 67513120
[(3S)-1-[1-(9H-fluorene-2-carbonyl)azetidin-3-yl]pyrrolidin-3-yl]-phenylmethanone (PubChem CID 67513120) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is [(3S)-1-[1-(9H-fluorene-2-carbonyl)azetidin-3-yl]pyrrolidin-3-yl]-phenylmethanone.
| Compound Name | [(3S)-1-[1-(9H-fluorene-2-carbonyl)azetidin-3-yl]pyrrolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 67513120 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [(3S)-1-[1-(9H-fluorene-2-carbonyl)azetidin-3-yl]pyrrolidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1CCN(C2CN(C(=O)c3ccc4c(c3)Cc3ccccc3-4)C2)C1 |
| InChI | InChI=1S/C28H26N2O2/c31-27(19-6-2-1-3-7-19)22-12-13-29(16-22)24-17-30(18-24)28(32)21-10-11-26-23(15-21)14-20-8-4-5-9-25(20)26/h1-11,15,22,24H,12-14,16-18H2/t22-/m0/s1 |
| InChIKey | PMRXBORDSUAZJB-QFIPXVFZSA-N |
| XLogP | 4.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |