C11H14N2O — CID 53326222
(NZ)-N-(7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)hydroxylamine (PubChem CID 53326222) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (NZ)-N-(7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 53326222 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (NZ)-N-(7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)hydroxylamine |
| SMILES | NC1CCc2ccccc2C/C1=N/O |
| InChI | InChI=1S/C11H14N2O/c12-10-6-5-8-3-1-2-4-9(8)7-11(10)13-14/h1-4,10,14H,5-7,12H2/b13-11- |
| InChIKey | JSVRMGJPPBJNFY-QBFSEMIESA-N |
| XLogP | 1.33 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|