C11H13NO — CID 24975348
7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-one (PubChem CID 24975348) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-one.
| Compound Name | 7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
|---|---|
| PubChem CID | 24975348 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-amino-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
| SMILES | NC1CCc2ccccc2CC1=O |
| InChI | InChI=1S/C11H13NO/c12-10-6-5-8-3-1-2-4-9(8)7-11(10)13/h1-4,10H,5-7,12H2 |
| InChIKey | CDGUKZZVDUXXJQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |