C11H13N3O — CID 142935930
N-[(Z)-(1-amino-1,3-dihydroinden-2-ylidene)amino]acetamide (PubChem CID 142935930) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is N-[(Z)-(1-amino-1,3-dihydroinden-2-ylidene)amino]acetamide.
| Compound Name | N-[(Z)-(1-amino-1,3-dihydroinden-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 142935930 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[(Z)-(1-amino-1,3-dihydroinden-2-ylidene)amino]acetamide |
| SMILES | CC(=O)N/N=C1/Cc2ccccc2C1N |
| InChI | InChI=1S/C11H13N3O/c1-7(15)13-14-10-6-8-4-2-3-5-9(8)11(10)12/h2-5,11H,6,12H2,1H3,(H,13,15)/b14-10- |
| InChIKey | FYZAOFGXLIWCPS-UVTDQMKNSA-N |
| XLogP | 0.73 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|