C8H10IN — CID 14617556
2,3-dihydro-1H-indolizin-4-ium iodide (PubChem CID 14617556) has the molecular formula C8H10IN and a molecular weight of 247.08 g/mol. Its IUPAC name is 2,3-dihydro-1H-indolizin-4-ium iodide.
| Compound Name | 2,3-dihydro-1H-indolizin-4-ium iodide |
|---|---|
| PubChem CID | 14617556 |
| Molecular Formula | C8H10IN |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 2,3-dihydro-1H-indolizin-4-ium iodide |
| SMILES | [I-].c1cc[n+]2c(c1)CCC2 |
| InChI | InChI=1S/C8H10N.HI/c1-2-6-9-7-3-5-8(9)4-1;/h1-2,4,6H,3,5,7H2;1H/q+1;/p-1 |
| InChIKey | WDHSKGMAGWJJLC-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|