C9H9N+2 — CID 90948567
3,4-dihydro-1H-quinolizin-5-ium-1-ylium (PubChem CID 90948567) has the molecular formula C9H9N+2 and a molecular weight of 131.18 g/mol. Its IUPAC name is 3,4-dihydro-1H-quinolizin-5-ium-1-ylium.
| Compound Name | 3,4-dihydro-1H-quinolizin-5-ium-1-ylium |
|---|---|
| PubChem CID | 90948567 |
| Molecular Formula | C9H9N+2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 3,4-dihydro-1H-quinolizin-5-ium-1-ylium |
| SMILES | [C+]1=CCC[n+]2ccccc21 |
| InChI | InChI=1S/C9H9N/c1-3-7-10-8-4-2-6-9(10)5-1/h1-3,5,7H,4,8H2/q+2 |
| InChIKey | SFPASVJKXRTSAB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|