C14H18N2O+2 — CID 69129683
7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene;ethanol (PubChem CID 69129683) has the molecular formula C14H18N2O+2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene;ethanol.
| Compound Name | 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene;ethanol |
|---|---|
| PubChem CID | 69129683 |
| Molecular Formula | C14H18N2O+2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaene;ethanol |
| SMILES | CCO.c1cc[n+]2c(c1)-c1cccc[n+]1CC2 |
| InChI | InChI=1S/C12H12N2.C2H6O/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1;1-2-3/h1-8H,9-10H2;3H,2H2,1H3/q+2; |
| InChIKey | OYTOXDGGHQALGQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|