C19H28N+ — CID 167702803
ethane;6,7,12,13-tetrahydropyrido[1,2-c][3]benzazocin-5-ium (PubChem CID 167702803) has the molecular formula C19H28N+ and a molecular weight of 270.44 g/mol. Its IUPAC name is ethane;6,7,12,13-tetrahydropyrido[1,2-c][3]benzazocin-5-ium.
| Compound Name | ethane;6,7,12,13-tetrahydropyrido[1,2-c][3]benzazocin-5-ium |
|---|---|
| PubChem CID | 167702803 |
| Molecular Formula | C19H28N+ |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | ethane;6,7,12,13-tetrahydropyrido[1,2-c][3]benzazocin-5-ium |
| SMILES | CC.CC.c1ccc2c(c1)CCc1cccc[n+]1CC2 |
| InChI | InChI=1S/C15H16N.2C2H6/c1-2-6-14-10-12-16-11-4-3-7-15(16)9-8-13(14)5-1;2*1-2/h1-7,11H,8-10,12H2;2*1-2H3/q+1;; |
| InChIKey | YQOUPIWMEPIUPT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|