C18H20 — CID 157285426
ethane;4,5,9,10-tetrahydropyrene (PubChem CID 157285426) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is ethane;4,5,9,10-tetrahydropyrene.
| Compound Name | ethane;4,5,9,10-tetrahydropyrene |
|---|---|
| PubChem CID | 157285426 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | ethane;4,5,9,10-tetrahydropyrene |
| SMILES | CC.c1cc2c3c(c1)CCc1cccc(c1-3)CC2 |
| InChI | InChI=1S/C16H14.C2H6/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-2/h1-6H,7-10H2;1-2H3 |
| InChIKey | BAEGTPXMLUEKAS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |