C19H22 — CID 144543507
ethane;2-methyl-4,5,9,10-tetrahydropyrene (PubChem CID 144543507) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is ethane;2-methyl-4,5,9,10-tetrahydropyrene.
| Compound Name | ethane;2-methyl-4,5,9,10-tetrahydropyrene |
|---|---|
| PubChem CID | 144543507 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;2-methyl-4,5,9,10-tetrahydropyrene |
| SMILES | CC.Cc1cc2c3c(c1)CCc1cccc(c1-3)CC2 |
| InChI | InChI=1S/C17H16.C2H6/c1-11-9-14-7-5-12-3-2-4-13-6-8-15(10-11)17(14)16(12)13;1-2/h2-4,9-10H,5-8H2,1H3;1-2H3 |
| InChIKey | HTGUZMXBZRIUKL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |