C22H28 — CID 91511464
2,7-dimethyl-4,5-dihydropyrene;ethane (PubChem CID 91511464) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2,7-dimethyl-4,5-dihydropyrene;ethane.
| Compound Name | 2,7-dimethyl-4,5-dihydropyrene;ethane |
|---|---|
| PubChem CID | 91511464 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2,7-dimethyl-4,5-dihydropyrene;ethane |
| SMILES | CC.CC.Cc1cc2c3c(ccc4cc(C)cc(c43)CC2)c1 |
| InChI | InChI=1S/C18H16.2C2H6/c1-11-7-13-3-5-15-9-12(2)10-16-6-4-14(8-11)17(13)18(15)16;2*1-2/h3,5,7-10H,4,6H2,1-2H3;2*1-2H3 |
| InChIKey | JIDFSQZRYJWXTD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|