C10H12ClN — CID 11095246
3-ethenyl-2,3-dihydro-1H-indolizin-4-ium chloride (PubChem CID 11095246) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is 3-ethenyl-2,3-dihydro-1H-indolizin-4-ium chloride.
| Compound Name | 3-ethenyl-2,3-dihydro-1H-indolizin-4-ium chloride |
|---|---|
| PubChem CID | 11095246 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-ethenyl-2,3-dihydro-1H-indolizin-4-ium chloride |
| SMILES | C=CC1CCc2cccc[n+]21.[Cl-] |
| InChI | InChI=1S/C10H12N.ClH/c1-2-9-6-7-10-5-3-4-8-11(9)10;/h2-5,8-9H,1,6-7H2;1H/q+1;/p-1 |
| InChIKey | YEOOPBVOJMUDAH-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|