C13H18O2S — CID 59108983
(3S,4R,5R)-3,4,5-trimethyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide (PubChem CID 59108983) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5-trimethyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide.
| Compound Name | (3S,4R,5R)-3,4,5-trimethyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide |
|---|---|
| PubChem CID | 59108983 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (3S,4R,5R)-3,4,5-trimethyl-2,3,4,5-tetrahydro-1λ6-benzothiepine 1,1-dioxide |
| SMILES | C[C@H]1[C@H](C)CS(=O)(=O)c2ccccc2[C@@H]1C |
| InChI | InChI=1S/C13H18O2S/c1-9-8-16(14,15)13-7-5-4-6-12(13)11(3)10(9)2/h4-7,9-11H,8H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | NPSMTNMRGQJCNE-OUAUKWLOSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |