C10H12NY- — CID 177158601
1,3-dimethyl-1,3-dihydroisoindol-2-ide;yttrium (PubChem CID 177158601) has the molecular formula C10H12NY- and a molecular weight of 235.12 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-dihydroisoindol-2-ide;yttrium.
| Compound Name | 1,3-dimethyl-1,3-dihydroisoindol-2-ide;yttrium |
|---|---|
| PubChem CID | 177158601 |
| Molecular Formula | C10H12NY- |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 1,3-dimethyl-1,3-dihydroisoindol-2-ide;yttrium |
| SMILES | CC1[N-]C(C)c2ccccc21.[Y] |
| InChI | InChI=1S/C10H12N.Y/c1-7-9-5-3-4-6-10(9)8(2)11-7;/h3-8H,1-2H3;/q-1; |
| InChIKey | XJDCQYWQOMKWJP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |