About 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol
2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol (PubChem CID 123381341) has the molecular formula C18H20N2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol |
| PubChem CID | 123381341 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol |
| SMILES | [H]/N=C(\C)N1c2ccccc2CC(CCS)c2ccccc21 |
| InChI | InChI=1S/C18H20N2S/c1-13(19)20-17-8-4-2-6-15(17)12-14(10-11-21)16-7-3-5-9-18(16)20/h2-9,14,19,21H,10-12H2,1H3/b19-13+ |
| InChIKey | VMEATOFRSLIXEX-CPNJWEJPSA-N |
| XLogP | 4.78 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol?
The IUPAC name of 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol (CID 123381341) is 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol.
What is the SMILES notation for 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol?
The canonical SMILES for 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol is [H]/N=C(\C)N1c2ccccc2CC(CCS)c2ccccc21.
What is the InChIKey of 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol?
The InChIKey is VMEATOFRSLIXEX-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H20N2S/c1-13(19)20-17-8-4-2-6-15(17)12-14(10-11-21)16-7-3-5-9-18(16)20/h2-9,14,19,21H,10-12H2,1H3/b19-13+.
What are the key properties of 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol?
2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol has a molecular weight of 296.44 g/mol, XLogP of 4.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(11-ethanimidoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl)ethanethiol is sourced from PubChem (CID 123381341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).