About ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium
ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium (PubChem CID 167450520) has the molecular formula C14H21NoOS2-
and a molecular weight of 528.46 g/mol. Its IUPAC name is ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium.
Molecular Properties
| Compound Name | ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium |
| PubChem CID | 167450520 |
| Molecular Formula | C14H21NoOS2- |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium |
| SMILES | CC.COC1C(c2cc[c-]cc2)SSC1(C)C.[No] |
| InChI | InChI=1S/C12H15OS2.C2H6.No/c1-12(2)11(13-3)10(14-15-12)9-7-5-4-6-8-9;1-2;/h5-8,10-11H,1-3H3;1-2H3;/q-1;; |
| InChIKey | KPJIZEUFCKDRQD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium?
The IUPAC name of ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium (CID 167450520) is ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium.
What is the SMILES notation for ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium?
The canonical SMILES for ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium is CC.COC1C(c2cc[c-]cc2)SSC1(C)C.[No].
What is the InChIKey of ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium?
The InChIKey is KPJIZEUFCKDRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15OS2.C2H6.No/c1-12(2)11(13-3)10(14-15-12)9-7-5-4-6-8-9;1-2;/h5-8,10-11H,1-3H3;1-2H3;/q-1;;.
What are the key properties of ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium?
ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium has a molecular weight of 528.46 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-3,3-dimethyl-5-phenyldithiolane;nobelium is sourced from PubChem (CID 167450520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).