C14H20O2 — CID 101393454
(2R,3S)-3-phenyl-2-propan-2-yloxyoxane (PubChem CID 101393454) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2R,3S)-3-phenyl-2-propan-2-yloxyoxane.
| Compound Name | (2R,3S)-3-phenyl-2-propan-2-yloxyoxane |
|---|---|
| PubChem CID | 101393454 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2R,3S)-3-phenyl-2-propan-2-yloxyoxane |
| SMILES | CC(C)O[C@H]1OCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-11(2)16-14-13(9-6-10-15-14)12-7-4-3-5-8-12/h3-5,7-8,11,13-14H,6,9-10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | DAZXXWCAFZVNSM-UONOGXRCSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |