C14H30NO2PS2 — CID 170710776
ethane;methoxy-piperidin-1-yl-(3,3,5-trimethyldithiolan-4-yl)oxyphosphane (PubChem CID 170710776) has the molecular formula C14H30NO2PS2 and a molecular weight of 339.51 g/mol. Its IUPAC name is ethane;methoxy-piperidin-1-yl-(3,3,5-trimethyldithiolan-4-yl)oxyphosphane.
| Compound Name | ethane;methoxy-piperidin-1-yl-(3,3,5-trimethyldithiolan-4-yl)oxyphosphane |
|---|---|
| PubChem CID | 170710776 |
| Molecular Formula | C14H30NO2PS2 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethane;methoxy-piperidin-1-yl-(3,3,5-trimethyldithiolan-4-yl)oxyphosphane |
| SMILES | CC.COP(OC1C(C)SSC1(C)C)N1CCCCC1 |
| InChI | InChI=1S/C12H24NO2PS2.C2H6/c1-10-11(12(2,3)18-17-10)15-16(14-4)13-8-6-5-7-9-13;1-2/h10-11H,5-9H2,1-4H3;1-2H3 |
| InChIKey | IBJHZCSHYIXJKX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|