C6H9F3S2 — CID 170710567
(5R)-3,3-dimethyl-5-(trifluoromethyl)dithiolane (PubChem CID 170710567) has the molecular formula C6H9F3S2 and a molecular weight of 202.27 g/mol. Its IUPAC name is (5R)-3,3-dimethyl-5-(trifluoromethyl)dithiolane.
| Compound Name | (5R)-3,3-dimethyl-5-(trifluoromethyl)dithiolane |
|---|---|
| PubChem CID | 170710567 |
| Molecular Formula | C6H9F3S2 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (5R)-3,3-dimethyl-5-(trifluoromethyl)dithiolane |
| SMILES | CC1(C)C[C@H](C(F)(F)F)SS1 |
| InChI | InChI=1S/C6H9F3S2/c1-5(2)3-4(10-11-5)6(7,8)9/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | XGFNBPCGQLQQJI-SCSAIBSYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|