C8H10F6OS2 — CID 167155400
4-methoxy-3,3-dimethyl-5,5-bis(trifluoromethyl)dithiolane (PubChem CID 167155400) has the molecular formula C8H10F6OS2 and a molecular weight of 300.29 g/mol. Its IUPAC name is 4-methoxy-3,3-dimethyl-5,5-bis(trifluoromethyl)dithiolane.
| Compound Name | 4-methoxy-3,3-dimethyl-5,5-bis(trifluoromethyl)dithiolane |
|---|---|
| PubChem CID | 167155400 |
| Molecular Formula | C8H10F6OS2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-methoxy-3,3-dimethyl-5,5-bis(trifluoromethyl)dithiolane |
| SMILES | COC1C(C)(C)SSC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6OS2/c1-5(2)4(15-3)6(17-16-5,7(9,10)11)8(12,13)14/h4H,1-3H3 |
| InChIKey | VBBJQWRSKHGOJP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|