C6H6F6O2S2 — CID 164565413
3,3-bis(trifluoromethyl)dithiane-4,5-diol (PubChem CID 164565413) has the molecular formula C6H6F6O2S2 and a molecular weight of 288.23 g/mol. Its IUPAC name is 3,3-bis(trifluoromethyl)dithiane-4,5-diol.
| Compound Name | 3,3-bis(trifluoromethyl)dithiane-4,5-diol |
|---|---|
| PubChem CID | 164565413 |
| Molecular Formula | C6H6F6O2S2 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 3,3-bis(trifluoromethyl)dithiane-4,5-diol |
| SMILES | OC1CSSC(C(F)(F)F)(C(F)(F)F)C1O |
| InChI | InChI=1S/C6H6F6O2S2/c7-5(8,9)4(6(10,11)12)3(14)2(13)1-15-16-4/h2-3,13-14H,1H2 |
| InChIKey | OSMQPUIWDOBBLY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|