C7H8F6S — CID 154348560
3-propyl-2,2-bis(trifluoromethyl)thiirane (PubChem CID 154348560) has the molecular formula C7H8F6S and a molecular weight of 238.20 g/mol. Its IUPAC name is 3-propyl-2,2-bis(trifluoromethyl)thiirane.
| Compound Name | 3-propyl-2,2-bis(trifluoromethyl)thiirane |
|---|---|
| PubChem CID | 154348560 |
| Molecular Formula | C7H8F6S |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-propyl-2,2-bis(trifluoromethyl)thiirane |
| SMILES | CCCC1SC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6S/c1-2-3-4-5(14-4,6(8,9)10)7(11,12)13/h4H,2-3H2,1H3 |
| InChIKey | VBRCYNFYUILXLX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|