C15H24F6 — CID 163290396
1-propyl-3,5-bis(3,3,3-trifluoropropyl)cyclohexane (PubChem CID 163290396) has the molecular formula C15H24F6 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-propyl-3,5-bis(3,3,3-trifluoropropyl)cyclohexane.
| Compound Name | 1-propyl-3,5-bis(3,3,3-trifluoropropyl)cyclohexane |
|---|---|
| PubChem CID | 163290396 |
| Molecular Formula | C15H24F6 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-propyl-3,5-bis(3,3,3-trifluoropropyl)cyclohexane |
| SMILES | CCCC1CC(CCC(F)(F)F)CC(CCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H24F6/c1-2-3-11-8-12(4-6-14(16,17)18)10-13(9-11)5-7-15(19,20)21/h11-13H,2-10H2,1H3 |
| InChIKey | OKRFHMPKBWRBIH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |