C12H21F3O2 — CID 82957761
4-propyl-2-(3,3,3-trifluoropropoxy)cyclohexan-1-ol (PubChem CID 82957761) has the molecular formula C12H21F3O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-propyl-2-(3,3,3-trifluoropropoxy)cyclohexan-1-ol.
| Compound Name | 4-propyl-2-(3,3,3-trifluoropropoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 82957761 |
| Molecular Formula | C12H21F3O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-propyl-2-(3,3,3-trifluoropropoxy)cyclohexan-1-ol |
| SMILES | CCCC1CCC(O)C(OCCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H21F3O2/c1-2-3-9-4-5-10(16)11(8-9)17-7-6-12(13,14)15/h9-11,16H,2-8H2,1H3 |
| InChIKey | KCBFDOLZPYYINB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |