C15H28F3NO — CID 82788586
N-ethyl-4-propyl-2-(4,4,4-trifluorobutoxy)cyclohexan-1-amine (PubChem CID 82788586) has the molecular formula C15H28F3NO and a molecular weight of 295.39 g/mol. Its IUPAC name is N-ethyl-4-propyl-2-(4,4,4-trifluorobutoxy)cyclohexan-1-amine.
| Compound Name | N-ethyl-4-propyl-2-(4,4,4-trifluorobutoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 82788586 |
| Molecular Formula | C15H28F3NO |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-ethyl-4-propyl-2-(4,4,4-trifluorobutoxy)cyclohexan-1-amine |
| SMILES | CCCC1CCC(NCC)C(OCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H28F3NO/c1-3-6-12-7-8-13(19-4-2)14(11-12)20-10-5-9-15(16,17)18/h12-14,19H,3-11H2,1-2H3 |
| InChIKey | UGSDXYHXECLMIK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|