C13H28 — CID 142054568
1,3-dimethyl-5-propylcyclohexane;ethane (PubChem CID 142054568) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is 1,3-dimethyl-5-propylcyclohexane;ethane.
| Compound Name | 1,3-dimethyl-5-propylcyclohexane;ethane |
|---|---|
| PubChem CID | 142054568 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 1,3-dimethyl-5-propylcyclohexane;ethane |
| SMILES | CC.CCCC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C11H22.C2H6/c1-4-5-11-7-9(2)6-10(3)8-11;1-2/h9-11H,4-8H2,1-3H3;1-2H3 |
| InChIKey | ORAALCIQYMAIMA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |