C17H32O — CID 64730670
1-(3,5-dimethylcyclohexyl)-4-propylcyclohexan-1-ol (PubChem CID 64730670) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-4-propylcyclohexan-1-ol.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64730670 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)(C2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C17H32O/c1-4-5-15-6-8-17(18,9-7-15)16-11-13(2)10-14(3)12-16/h13-16,18H,4-12H2,1-3H3 |
| InChIKey | LEJZDAARQFQVMS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |