C21H38O — CID 59969086
1-(4-methylcyclohexyl)-4-[(4-methylcyclohexyl)methyl]cyclohexan-1-ol (PubChem CID 59969086) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-4-[(4-methylcyclohexyl)methyl]cyclohexan-1-ol.
| Compound Name | 1-(4-methylcyclohexyl)-4-[(4-methylcyclohexyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 59969086 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 1-(4-methylcyclohexyl)-4-[(4-methylcyclohexyl)methyl]cyclohexan-1-ol |
| SMILES | CC1CCC(CC2CCC(O)(C3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C21H38O/c1-16-3-7-18(8-4-16)15-19-11-13-21(22,14-12-19)20-9-5-17(2)6-10-20/h16-20,22H,3-15H2,1-2H3 |
| InChIKey | AIBBOOIADQMUBI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |