C11H16F6O2 — CID 22213957
(4R,5R)-4-butyl-5-ethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 22213957) has the molecular formula C11H16F6O2 and a molecular weight of 294.24 g/mol. Its IUPAC name is (4R,5R)-4-butyl-5-ethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-4-butyl-5-ethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 22213957 |
| Molecular Formula | C11H16F6O2 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (4R,5R)-4-butyl-5-ethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | CCCC[C@H]1OC(C(F)(F)F)(C(F)(F)F)O[C@@H]1CC |
| InChI | InChI=1S/C11H16F6O2/c1-3-5-6-8-7(4-2)18-9(19-8,10(12,13)14)11(15,16)17/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | GYAVUBUHGQUNDC-HTQZYQBOSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |