C9H10ClF5 — CID 88740562
2-[(Z)-1-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-1,1-dimethylcyclopropane (PubChem CID 88740562) has the molecular formula C9H10ClF5 and a molecular weight of 248.62 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-1,1-dimethylcyclopropane.
| Compound Name | 2-[(Z)-1-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 88740562 |
| Molecular Formula | C9H10ClF5 |
| Molecular Weight | 248.62 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-[(Z)-1-chloro-3,3,4,4,4-pentafluorobut-1-enyl]-1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1/C(Cl)=C/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10ClF5/c1-7(2)3-5(7)6(10)4-8(11,12)9(13,14)15/h4-5H,3H2,1-2H3/b6-4- |
| InChIKey | JESNWUQDFSVLIM-XQRVVYSFSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|