C8H16OS — CID 144679012
2,2-dimethyl-5-sulfanylcyclohexan-1-ol (PubChem CID 144679012) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-sulfanylcyclohexan-1-ol.
| Compound Name | 2,2-dimethyl-5-sulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 144679012 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2,2-dimethyl-5-sulfanylcyclohexan-1-ol |
| SMILES | CC1(C)CCC(S)CC1O |
| InChI | InChI=1S/C8H16OS/c1-8(2)4-3-6(10)5-7(8)9/h6-7,9-10H,3-5H2,1-2H3 |
| InChIKey | BOVFFKNJRGITNB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|