C8H18ClNO — CID 89158271
5-amino-2,2-dimethylcyclohexan-1-ol;hydrochloride (PubChem CID 89158271) has the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. Its IUPAC name is 5-amino-2,2-dimethylcyclohexan-1-ol;hydrochloride.
| Compound Name | 5-amino-2,2-dimethylcyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 89158271 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-amino-2,2-dimethylcyclohexan-1-ol;hydrochloride |
| SMILES | CC1(C)CCC(N)CC1O.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-8(2)4-3-6(9)5-7(8)10;/h6-7,10H,3-5,9H2,1-2H3;1H |
| InChIKey | JKCNWOQIDZDLSO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |