C5H13Cl2NO — CID 121471734
cis-(1R,3S)-3-aminocyclopentan-1-ol;dihydrochloride (PubChem CID 121471734) has the molecular formula C5H13Cl2NO and a molecular weight of 174.07 g/mol. Its IUPAC name is cis-(1R,3S)-3-aminocyclopentan-1-ol;dihydrochloride.
| Compound Name | cis-(1R,3S)-3-aminocyclopentan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 121471734 |
| Molecular Formula | C5H13Cl2NO |
| Molecular Weight | 174.07 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | cis-(1R,3S)-3-aminocyclopentan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C5H11NO.2ClH/c6-4-1-2-5(7)3-4;;/h4-5,7H,1-3,6H2;2*1H/t4-,5+;;/m0../s1 |
| InChIKey | KZKNHGZNNQNVGZ-YAQRUTEZSA-N |
| XLogP | 0.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.07 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |