C7H17Cl2NO — CID 175054137
cis-(1S,3R)-3-aminocycloheptan-1-ol;dihydrochloride (PubChem CID 175054137) has the molecular formula C7H17Cl2NO and a molecular weight of 202.12 g/mol. Its IUPAC name is cis-(1S,3R)-3-aminocycloheptan-1-ol;dihydrochloride.
| Compound Name | cis-(1S,3R)-3-aminocycloheptan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 175054137 |
| Molecular Formula | C7H17Cl2NO |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | cis-(1S,3R)-3-aminocycloheptan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCCC[C@H](O)C1 |
| InChI | InChI=1S/C7H15NO.2ClH/c8-6-3-1-2-4-7(9)5-6;;/h6-7,9H,1-5,8H2;2*1H/t6-,7+;;/m1../s1 |
| InChIKey | ALLKUBFADBCDQI-VJBFUYBPSA-N |
| XLogP | 1.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |