C8H16O3S — CID 165022353
(2S,4R,5R)-4-methoxy-5-(methoxymethyl)-2-methylthiolan-3-ol (PubChem CID 165022353) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is (2S,4R,5R)-4-methoxy-5-(methoxymethyl)-2-methylthiolan-3-ol.
| Compound Name | (2S,4R,5R)-4-methoxy-5-(methoxymethyl)-2-methylthiolan-3-ol |
|---|---|
| PubChem CID | 165022353 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2S,4R,5R)-4-methoxy-5-(methoxymethyl)-2-methylthiolan-3-ol |
| SMILES | COC[C@H]1S[C@@H](C)C(O)[C@H]1OC |
| InChI | InChI=1S/C8H16O3S/c1-5-7(9)8(11-3)6(12-5)4-10-2/h5-9H,4H2,1-3H3/t5-,6+,7?,8-/m0/s1 |
| InChIKey | YHPNXQLWLKVUDB-WHBCSPCOSA-N |
| XLogP | 0.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |