C7H12O4S — CID 118336573
(4S,5R)-4-hydroxy-2-methoxy-5-(methoxymethyl)thiolan-3-one (PubChem CID 118336573) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is (4S,5R)-4-hydroxy-2-methoxy-5-(methoxymethyl)thiolan-3-one.
| Compound Name | (4S,5R)-4-hydroxy-2-methoxy-5-(methoxymethyl)thiolan-3-one |
|---|---|
| PubChem CID | 118336573 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (4S,5R)-4-hydroxy-2-methoxy-5-(methoxymethyl)thiolan-3-one |
| SMILES | COC[C@H]1SC(OC)C(=O)[C@@H]1O |
| InChI | InChI=1S/C7H12O4S/c1-10-3-4-5(8)6(9)7(11-2)12-4/h4-5,7-8H,3H2,1-2H3/t4-,5-,7?/m1/s1 |
| InChIKey | INPMNNNWYNRHJM-YDQIFQPMSA-N |
| XLogP | -0.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |