C7H13BO3S — CID 154603491
CID 154603491 (PubChem CID 154603491) has the molecular formula C7H13BO3S and a molecular weight of 188.06 g/mol.
| Compound Name | CID 154603491 |
|---|---|
| PubChem CID | 154603491 |
| Molecular Formula | C7H13BO3S |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1S[C@H](COC)[C@H](OC)C1O |
| InChI | InChI=1S/C7H13BO3S/c1-10-3-4-6(11-2)5(9)7(8)12-4/h4-7,9H,3H2,1-2H3/t4-,5?,6+,7-/m1/s1 |
| InChIKey | ZAGLFBPOBDLKMR-ZFGFBIEISA-N |
| XLogP | -0.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|