About CID 166559451
CID 166559451 (PubChem CID 166559451) has the molecular formula C11H22BO5PS
and a molecular weight of 308.15 g/mol.
Molecular Properties
| Compound Name | CID 166559451 |
| PubChem CID | 166559451 |
| Molecular Formula | C11H22BO5PS |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1S[C@H](COC(C)C)[C@@H](OP(=O)(O)C(C)C)[C@H]1O |
| InChI | InChI=1S/C11H22BO5PS/c1-6(2)16-5-8-10(9(13)11(12)19-8)17-18(14,15)7(3)4/h6-11,13H,5H2,1-4H3,(H,14,15)/t8-,9-,10-,11-/m1/s1 |
| InChIKey | OOBKXMZKBDLFKO-GWOFURMSSA-N |
| XLogP | 1.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 166559451 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166559451?
The IUPAC name of CID 166559451 (CID 166559451) is not available.
What is the SMILES notation for CID 166559451?
The canonical SMILES for CID 166559451 is [B][C@@H]1S[C@H](COC(C)C)[C@@H](OP(=O)(O)C(C)C)[C@H]1O.
What is the InChIKey of CID 166559451?
The InChIKey is OOBKXMZKBDLFKO-GWOFURMSSA-N. The full InChI is InChI=1S/C11H22BO5PS/c1-6(2)16-5-8-10(9(13)11(12)19-8)17-18(14,15)7(3)4/h6-11,13H,5H2,1-4H3,(H,14,15)/t8-,9-,10-,11-/m1/s1.
What are the key properties of CID 166559451?
CID 166559451 has a molecular weight of 308.15 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166559451 is sourced from PubChem (CID 166559451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).