C16H26FN6O5P — CID 176598654
[(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 176598654) has the molecular formula C16H26FN6O5P and a molecular weight of 432.39 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 176598654 |
| Molecular Formula | C16H26FN6O5P |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(2R,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-2-(propan-2-yloxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | CC(C)OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@@H](F)C1OP(=O)(O)C(C)C |
| InChI | InChI=1S/C16H26FN6O5P/c1-7(2)26-5-9-12(28-29(24,25)8(3)4)10(17)15(27-9)23-6-20-11-13(18)21-16(19)22-14(11)23/h6-10,12,15H,5H2,1-4H3,(H,24,25)(H4,18,19,21,22)/t9-,10+,12?,15-/m1/s1 |
| InChIKey | HIYHSOOYZYFKQV-GSGPYMITSA-N |
| XLogP | 1.63 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|