C18H31N6O6P — CID 166589389
tert-butyl-[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-4-methoxy-2-(propan-2-yloxymethyl)oxolan-3-yl]oxyphosphinic acid (PubChem CID 166589389) has the molecular formula C18H31N6O6P and a molecular weight of 458.46 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-4-methoxy-2-(propan-2-yloxymethyl)oxolan-3-yl]oxyphosphinic acid.
| Compound Name | tert-butyl-[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-4-methoxy-2-(propan-2-yloxymethyl)oxolan-3-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 166589389 |
| Molecular Formula | C18H31N6O6P |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | tert-butyl-[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-4-methoxy-2-(propan-2-yloxymethyl)oxolan-3-yl]oxyphosphinic acid |
| SMILES | COC1[C@@H](OP(=O)(O)C(C)(C)C)[C@@H](COC(C)C)O[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C18H31N6O6P/c1-9(2)28-7-10-12(30-31(25,26)18(3,4)5)13(27-6)16(29-10)24-8-21-11-14(19)22-17(20)23-15(11)24/h8-10,12-13,16H,7H2,1-6H3,(H,25,26)(H4,19,20,22,23)/t10-,12+,13?,16-/m1/s1 |
| InChIKey | CPMABCYPZSOHPL-QEFZCKDJSA-N |
| XLogP | 1.70 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|