C18H30N6O5PS- — CID 166589377
9-[(2R,4S,5R)-4-[tert-butyl(oxido)phosphinothioyl]oxy-3-methoxy-5-(propan-2-yloxymethyl)oxolan-2-yl]purine-2,6-diamine (PubChem CID 166589377) has the molecular formula C18H30N6O5PS- and a molecular weight of 473.52 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-[tert-butyl(oxido)phosphinothioyl]oxy-3-methoxy-5-(propan-2-yloxymethyl)oxolan-2-yl]purine-2,6-diamine.
| Compound Name | 9-[(2R,4S,5R)-4-[tert-butyl(oxido)phosphinothioyl]oxy-3-methoxy-5-(propan-2-yloxymethyl)oxolan-2-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 166589377 |
| Molecular Formula | C18H30N6O5PS- |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 9-[(2R,4S,5R)-4-[tert-butyl(oxido)phosphinothioyl]oxy-3-methoxy-5-(propan-2-yloxymethyl)oxolan-2-yl]purine-2,6-diamine |
| SMILES | COC1[C@@H](OP([O-])(=S)C(C)(C)C)[C@@H](COC(C)C)O[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C18H31N6O5PS/c1-9(2)27-7-10-12(29-30(25,31)18(3,4)5)13(26-6)16(28-10)24-8-21-11-14(19)22-17(20)23-15(11)24/h8-10,12-13,16H,7H2,1-6H3,(H,25,31)(H4,19,20,22,23)/p-1/t10-,12+,13?,16-,30?/m1/s1 |
| InChIKey | BUJNARSUULKEDW-ZUGGISSOSA-M |
| XLogP | 1.18 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|