C9H20N2O — CID 163574132
3,4-diamino-2,5,6-trimethylcyclohexan-1-ol (PubChem CID 163574132) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 3,4-diamino-2,5,6-trimethylcyclohexan-1-ol.
| Compound Name | 3,4-diamino-2,5,6-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 163574132 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 3,4-diamino-2,5,6-trimethylcyclohexan-1-ol |
| SMILES | CC1C(C)C(O)C(C)C(N)C1N |
| InChI | InChI=1S/C9H20N2O/c1-4-5(2)9(12)6(3)8(11)7(4)10/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | GBYIXRCLKLGLHM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |