C5H11NO — CID 131846797
[(1S,2R,3S)-2-amino-3-methylcyclopropyl]methanol (PubChem CID 131846797) has the molecular formula C5H11NO and a molecular weight of 101.15 g/mol. Its IUPAC name is [(1S,2R,3S)-2-amino-3-methylcyclopropyl]methanol.
| Compound Name | [(1S,2R,3S)-2-amino-3-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 131846797 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | [(1S,2R,3S)-2-amino-3-methylcyclopropyl]methanol |
| SMILES | C[C@@H]1[C@@H](N)[C@H]1CO |
| InChI | InChI=1S/C5H11NO/c1-3-4(2-7)5(3)6/h3-5,7H,2,6H2,1H3/t3-,4-,5+/m0/s1 |
| InChIKey | AXHXZUPZAKMKRX-VAYJURFESA-N |
| XLogP | -0.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |