C9H19NO2 — CID 59870886
(2R,4R,6R)-5-amino-2-ethyl-4,6-dimethyloxan-3-ol (PubChem CID 59870886) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2R,4R,6R)-5-amino-2-ethyl-4,6-dimethyloxan-3-ol.
| Compound Name | (2R,4R,6R)-5-amino-2-ethyl-4,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 59870886 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2R,4R,6R)-5-amino-2-ethyl-4,6-dimethyloxan-3-ol |
| SMILES | CC[C@H]1O[C@H](C)C(N)[C@@H](C)C1O |
| InChI | InChI=1S/C9H19NO2/c1-4-7-9(11)5(2)8(10)6(3)12-7/h5-9,11H,4,10H2,1-3H3/t5-,6-,7-,8?,9?/m1/s1 |
| InChIKey | GHRSWPNRYBSDLM-YVAABNCISA-N |
| XLogP | 0.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |