C8H16O3 — CID 59897700
(5R)-3,5,6-trimethyloxane-2,4-diol (PubChem CID 59897700) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (5R)-3,5,6-trimethyloxane-2,4-diol.
| Compound Name | (5R)-3,5,6-trimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 59897700 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (5R)-3,5,6-trimethyloxane-2,4-diol |
| SMILES | CC1C(O)OC(C)[C@H](C)C1O |
| InChI | InChI=1S/C8H16O3/c1-4-6(3)11-8(10)5(2)7(4)9/h4-10H,1-3H3/t4-,5?,6?,7?,8?/m0/s1 |
| InChIKey | LOXXCWWKKVFWBT-DKBGPPMCSA-N |
| XLogP | 0.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |