About CID 58545492
CID 58545492 (PubChem CID 58545492) has the molecular formula C6H11BO2
and a molecular weight of 125.96 g/mol.
Molecular Properties
| Compound Name | CID 58545492 |
| PubChem CID | 58545492 |
| Molecular Formula | C6H11BO2 |
| Molecular Weight | 125.96 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | — |
| SMILES | [B][C@H]1O[C@H](C)C(C)C1O |
| InChI | InChI=1S/C6H11BO2/c1-3-4(2)9-6(7)5(3)8/h3-6,8H,1-2H3/t3?,4-,5?,6+/m1/s1 |
| InChIKey | AUNZEWSBQFRMEY-IJBOSRHISA-N |
| XLogP | -0.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.96 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58545492 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58545492?
The IUPAC name of CID 58545492 (CID 58545492) is not available.
What is the SMILES notation for CID 58545492?
The canonical SMILES for CID 58545492 is [B][C@H]1O[C@H](C)C(C)C1O.
What is the InChIKey of CID 58545492?
The InChIKey is AUNZEWSBQFRMEY-IJBOSRHISA-N. The full InChI is InChI=1S/C6H11BO2/c1-3-4(2)9-6(7)5(3)8/h3-6,8H,1-2H3/t3?,4-,5?,6+/m1/s1.
What are the key properties of CID 58545492?
CID 58545492 has a molecular weight of 125.96 g/mol, XLogP of -0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58545492 is sourced from PubChem (CID 58545492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).