C8H16O4 — CID 165082057
(2R,3S,4R,5R,6R)-6-(hydroxymethyl)-3,5-dimethyloxane-2,4-diol (PubChem CID 165082057) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-6-(hydroxymethyl)-3,5-dimethyloxane-2,4-diol.
| Compound Name | (2R,3S,4R,5R,6R)-6-(hydroxymethyl)-3,5-dimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 165082057 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R,3S,4R,5R,6R)-6-(hydroxymethyl)-3,5-dimethyloxane-2,4-diol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](C)[C@H](O)O[C@H]1CO |
| InChI | InChI=1S/C8H16O4/c1-4-6(3-9)12-8(11)5(2)7(4)10/h4-11H,3H2,1-2H3/t4-,5-,6-,7+,8+/m0/s1 |
| InChIKey | MCMYSIRYFBHIJI-QYYLWSOASA-N |
| XLogP | -0.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |