C3H9O12P3 — CID 172770499
2,6,10-trihydroxy-1,3,5,7,9,11-hexaoxa-2λ5,6λ5,10λ5-triphosphacyclododecane 2,6,10-trioxide (PubChem CID 172770499) has the molecular formula C3H9O12P3 and a molecular weight of 330.02 g/mol. Its IUPAC name is 2,6,10-trihydroxy-1,3,5,7,9,11-hexaoxa-2λ5,6λ5,10λ5-triphosphacyclododecane 2,6,10-trioxide.
| Compound Name | 2,6,10-trihydroxy-1,3,5,7,9,11-hexaoxa-2λ5,6λ5,10λ5-triphosphacyclododecane 2,6,10-trioxide |
|---|---|
| PubChem CID | 172770499 |
| Molecular Formula | C3H9O12P3 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 2,6,10-trihydroxy-1,3,5,7,9,11-hexaoxa-2λ5,6λ5,10λ5-triphosphacyclododecane 2,6,10-trioxide |
| SMILES | O=P1(O)OCOP(=O)(O)OCOP(=O)(O)OCO1 |
| InChI | InChI=1S/C3H9O12P3/c4-16(5)10-1-11-17(6,7)13-3-15-18(8,9)14-2-12-16/h1-3H2,(H,4,5)(H,6,7)(H,8,9) |
| InChIKey | JVWJSUAXNUBHEF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|